About 8-(furan-2-yl)octanoic acid
8-(furan-2-yl)octanoic acid (PubChem CID 11790484) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 8-(furan-2-yl)octanoic acid.
Molecular Properties
| Compound Name | 8-(furan-2-yl)octanoic acid |
| PubChem CID | 11790484 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 8-(furan-2-yl)octanoic acid |
| SMILES | O=C(O)CCCCCCCc1ccco1 |
| InChI | InChI=1S/C12H18O3/c13-12(14)9-5-3-1-2-4-7-11-8-6-10-15-11/h6,8,10H,1-5,7,9H2,(H,13,14) |
| InChIKey | SXQRVQKQTIWUKR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(furan-2-yl)octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(furan-2-yl)octanoic acid?
The IUPAC name of 8-(furan-2-yl)octanoic acid (CID 11790484) is 8-(furan-2-yl)octanoic acid.
What is the SMILES notation for 8-(furan-2-yl)octanoic acid?
The canonical SMILES for 8-(furan-2-yl)octanoic acid is O=C(O)CCCCCCCc1ccco1.
What is the InChIKey of 8-(furan-2-yl)octanoic acid?
The InChIKey is SXQRVQKQTIWUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c13-12(14)9-5-3-1-2-4-7-11-8-6-10-15-11/h6,8,10H,1-5,7,9H2,(H,13,14).
What are the key properties of 8-(furan-2-yl)octanoic acid?
8-(furan-2-yl)octanoic acid has a molecular weight of 210.27 g/mol, XLogP of 3.25, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(furan-2-yl)octanoic acid is sourced from PubChem (CID 11790484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).