C14H30O3 — CID 11791485
5-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylpentan-1-ol (PubChem CID 11791485) has the molecular formula C14H30O3 and a molecular weight of 246.39 g/mol. Its IUPAC name is 5-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylpentan-1-ol.
| Compound Name | 5-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 11791485 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 5-(5-hydroxy-4,4-dimethylpentoxy)-2,2-dimethylpentan-1-ol |
| SMILES | CC(C)(CO)CCCOCCCC(C)(C)CO |
| InChI | InChI=1S/C14H30O3/c1-13(2,11-15)7-5-9-17-10-6-8-14(3,4)12-16/h15-16H,5-12H2,1-4H3 |
| InChIKey | HNQAWXUFVQFLCS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|