C16H33NO4Si2 — CID 11792833
[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-trimethylsilylazetidin-2-yl] acetate (PubChem CID 11792833) has the molecular formula C16H33NO4Si2 and a molecular weight of 359.62 g/mol. Its IUPAC name is [(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-trimethylsilylazetidin-2-yl] acetate.
| Compound Name | [(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-trimethylsilylazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 11792833 |
| Molecular Formula | C16H33NO4Si2 |
| Molecular Weight | 359.62 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | [(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-1-trimethylsilylazetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1[Si](C)(C)C |
| InChI | InChI=1S/C16H33NO4Si2/c1-11(21-23(9,10)16(3,4)5)13-14(19)17(22(6,7)8)15(13)20-12(2)18/h11,13,15H,1-10H3/t11-,13+,15-/m1/s1 |
| InChIKey | DJIQLEXJUGGETD-OSAQELSMSA-N |
| XLogP | 3.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|