C17H22F2N4O3 — CID 11793368
(2R,3R)-2-(2,4-difluorophenyl)-3-[1,3-dioxolan-2-ylmethyl(methyl)amino]-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 11793368) has the molecular formula C17H22F2N4O3 and a molecular weight of 368.38 g/mol. Its IUPAC name is (2R,3R)-2-(2,4-difluorophenyl)-3-[1,3-dioxolan-2-ylmethyl(methyl)amino]-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[1,3-dioxolan-2-ylmethyl(methyl)amino]-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 11793368 |
| Molecular Formula | C17H22F2N4O3 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-[1,3-dioxolan-2-ylmethyl(methyl)amino]-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](N(C)CC1OCCO1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H22F2N4O3/c1-12(22(2)8-16-25-5-6-26-16)17(24,9-23-11-20-10-21-23)14-4-3-13(18)7-15(14)19/h3-4,7,10-12,16,24H,5-6,8-9H2,1-2H3/t12-,17-/m1/s1 |
| InChIKey | AITGVFBRRSSNTI-SJKOYZFVSA-N |
| XLogP | 1.14 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |