C26H20ClF3N2O2 — CID 117937367
[6-Chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 117937367) has the molecular formula C26H20ClF3N2O2 and a molecular weight of 484.90 g/mol. Its IUPAC name is [6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [6-Chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 117937367 |
| Molecular Formula | C26H20ClF3N2O2 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | [6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | COC1=CC=C(C=C1)C2C3=C(CCN2C(=O)C4=CC=C(C=C4)C(F)(F)F)C5=C(N3)C=CC(=C5)Cl |
| InChI | InChI=1S/C26H20ClF3N2O2/c1-34-19-9-4-15(5-10-19)24-23-20(21-14-18(27)8-11-22(21)31-23)12-13-32(24)25(33)16-2-6-17(7-3-16)26(28,29)30/h2-11,14,24,31H,12-13H2,1H3 |
| InChIKey | DUGZPNYCEBCVKR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 45.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | 721 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|