C19H27NO7 — CID 11794217
benzyl 2-[(2R,3aR,4R,5R)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]acetate (PubChem CID 11794217) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is benzyl 2-[(2R,3aR,4R,5R)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]acetate.
| Compound Name | benzyl 2-[(2R,3aR,4R,5R)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]acetate |
|---|---|
| PubChem CID | 11794217 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | benzyl 2-[(2R,3aR,4R,5R)-4,5-bis(methoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]acetate |
| SMILES | COCO[C@@H]1[C@H]2C[C@H](CC(=O)OCc3ccccc3)ON2C[C@H]1OCOC |
| InChI | InChI=1S/C19H27NO7/c1-22-12-25-17-10-20-16(19(17)26-13-23-2)8-15(27-20)9-18(21)24-11-14-6-4-3-5-7-14/h3-7,15-17,19H,8-13H2,1-2H3/t15-,16-,17-,19-/m1/s1 |
| InChIKey | YCHLCTANARTSNK-YWTNHNAXSA-N |
| XLogP | 1.49 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|