C19H27NO7 — CID 134883774
[(2S,3aS,4S,5R)-2-(2-hydroxyethyl)-5-(2-methoxyethoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] benzoate (PubChem CID 134883774) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is [(2S,3aS,4S,5R)-2-(2-hydroxyethyl)-5-(2-methoxyethoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] benzoate.
| Compound Name | [(2S,3aS,4S,5R)-2-(2-hydroxyethyl)-5-(2-methoxyethoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] benzoate |
|---|---|
| PubChem CID | 134883774 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [(2S,3aS,4S,5R)-2-(2-hydroxyethyl)-5-(2-methoxyethoxymethoxy)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] benzoate |
| SMILES | COCCOCO[C@@H]1CN2O[C@H](CCO)C[C@H]2[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H27NO7/c1-23-9-10-24-13-25-17-12-20-16(11-15(27-20)7-8-21)18(17)26-19(22)14-5-3-2-4-6-14/h2-6,15-18,21H,7-13H2,1H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | XLTXAEPNBYPORP-XDNAFOTISA-N |
| XLogP | 0.99 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|