C18H21N3O7 — CID 538850
[2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-azidoethyl] benzoate (PubChem CID 538850) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is [2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-azidoethyl] benzoate.
| Compound Name | [2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-azidoethyl] benzoate |
|---|---|
| PubChem CID | 538850 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-azidoethyl] benzoate |
| SMILES | CC(=O)OC1C(C(COC(=O)c2ccccc2)N=[N+]=[N-])OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C18H21N3O7/c1-10(22)25-14-13(26-17-15(14)27-18(2,3)28-17)12(20-21-19)9-24-16(23)11-7-5-4-6-8-11/h4-8,12-15,17H,9H2,1-3H3 |
| InChIKey | CRESIJJFPOWFPD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|