C19H27N3O5 — CID 11057919
(4R,5S)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11057919) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is (4R,5S)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11057919 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (4R,5S)-4-[(1R)-1-azido-2-phenylmethoxyethyl]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@H]([C@@H](COCc2ccccc2)N=[N+]=[N-])[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C19H27N3O5/c1-18(2)24-12-15(25-18)17-16(26-19(3,4)27-17)14(21-22-20)11-23-10-13-8-6-5-7-9-13/h5-9,14-17H,10-12H2,1-4H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | CHYXBZPNCOOAAU-QBPKDAKJSA-N |
| XLogP | 3.55 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|