C14H16FN3O4 — CID 135013668
(2R,4aR,6S,7R,7aS)-7-azido-6-[fluoro(methoxy)methyl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine (PubChem CID 135013668) has the molecular formula C14H16FN3O4 and a molecular weight of 309.30 g/mol. Its IUPAC name is (2R,4aR,6S,7R,7aS)-7-azido-6-[fluoro(methoxy)methyl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7R,7aS)-7-azido-6-[fluoro(methoxy)methyl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 135013668 |
| Molecular Formula | C14H16FN3O4 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2R,4aR,6S,7R,7aS)-7-azido-6-[fluoro(methoxy)methyl]-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
| SMILES | COC(F)[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H16FN3O4/c1-19-13(15)12-10(17-18-16)11-9(21-12)7-20-14(22-11)8-5-3-2-4-6-8/h2-6,9-14H,7H2,1H3/t9-,10-,11-,12+,13?,14-/m1/s1 |
| InChIKey | UCMYQAWRFDOMBM-QFIBJEGBSA-N |
| XLogP | 2.49 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|