C14H18FN3O3 — CID 134934457
(2S,3S,4S,5R,6R)-5-azido-4-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane (PubChem CID 134934457) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-5-azido-4-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane.
| Compound Name | (2S,3S,4S,5R,6R)-5-azido-4-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 134934457 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2S,3S,4S,5R,6R)-5-azido-4-fluoro-2-methoxy-6-methyl-3-phenylmethoxyoxane |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](F)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H18FN3O3/c1-9-12(17-18-16)11(15)13(14(19-2)21-9)20-8-10-6-4-3-5-7-10/h3-7,9,11-14H,8H2,1-2H3/t9-,11+,12-,13-,14+/m1/s1 |
| InChIKey | MTXYHYXQUQAOSL-WJUUCBRBSA-N |
| XLogP | 2.98 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|