C13H14FN3O3 — CID 135024252
(2R,5R)-4-azido-3-fluoro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 135024252) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is (2R,5R)-4-azido-3-fluoro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (2R,5R)-4-azido-3-fluoro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 135024252 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (2R,5R)-4-azido-3-fluoro-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | [N-]=[N+]=NC1C(F)[C@H](OCc2ccccc2)C2CO[C@@H]1O2 |
| InChI | InChI=1S/C13H14FN3O3/c14-10-11(16-17-15)13-19-7-9(20-13)12(10)18-6-8-4-2-1-3-5-8/h1-5,9-13H,6-7H2/t9?,10?,11?,12-,13-/m1/s1 |
| InChIKey | MGZUIOZKQSASPI-FRRVBIHZSA-N |
| XLogP | 2.34 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|