C25H23NO3 — CID 11794494
[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] N,N-diethylcarbamate (PubChem CID 11794494) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] N,N-diethylcarbamate.
| Compound Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 11794494 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C25H23NO3/c1-3-26(4-2)25(28)29-22-16-14-18-10-6-8-12-20(18)24(22)23-19-11-7-5-9-17(19)13-15-21(23)27/h5-16,27H,3-4H2,1-2H3 |
| InChIKey | QERYOUYMAKMPJJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |