C23H42O3Si — CID 11794965
2-[(2S,4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yl acetate (PubChem CID 11794965) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is 2-[(2S,4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yl acetate.
| Compound Name | 2-[(2S,4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yl acetate |
|---|---|
| PubChem CID | 11794965 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 2-[(2S,4S,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)[C@H]1CC2=C(C)CCC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H42O3Si/c1-16-12-11-13-23(8)19(16)14-18(22(6,7)25-17(2)24)15-20(23)26-27(9,10)21(3,4)5/h18,20H,11-15H2,1-10H3/t18-,20-,23-/m0/s1 |
| InChIKey | GIZDZYJDRAKXLM-LEDOBFOHSA-N |
| XLogP | 6.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|