C21H40O3Si — CID 11025023
[(1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexyl] acetate (PubChem CID 11025023) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is [(1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexyl] acetate.
| Compound Name | [(1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexyl] acetate |
|---|---|
| PubChem CID | 11025023 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | [(1R,2R,5R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohexyl] acetate |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(CCO[Si](C)(C)C(C)(C)C)[C@H](OC(C)=O)[C@H]1C |
| InChI | InChI=1S/C21H40O3Si/c1-15(2)18-11-12-21(8,19(16(18)3)24-17(4)22)13-14-23-25(9,10)20(5,6)7/h16,18-19H,1,11-14H2,2-10H3/t16-,18-,19+,21+/m0/s1 |
| InChIKey | JHDXDHDSYCAMAT-XFIJJGBISA-N |
| XLogP | 5.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|