C20H41NO3Si2 — CID 11795241
(1S,2R,8aS)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11795241) has the molecular formula C20H41NO3Si2 and a molecular weight of 399.72 g/mol. Its IUPAC name is (1S,2R,8aS)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (1S,2R,8aS)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11795241 |
| Molecular Formula | C20H41NO3Si2 |
| Molecular Weight | 399.72 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (1S,2R,8aS)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2CCCC[C@@H]12 |
| InChI | InChI=1S/C20H41NO3Si2/c1-19(2,3)25(7,8)23-16-15-13-11-12-14-21(15)18(22)17(16)24-26(9,10)20(4,5)6/h15-17H,11-14H2,1-10H3/t15-,16-,17+/m0/s1 |
| InChIKey | MCLBNZDIZWAESX-YESZJQIVSA-N |
| XLogP | 5.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|