C27H23N3O2 — CID 11796452
N-[4-[(5E)-5-(cyanomethylidene)-3,4-dihydro-2H-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide (PubChem CID 11796452) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[4-[(5E)-5-(cyanomethylidene)-3,4-dihydro-2H-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[4-[(5E)-5-(cyanomethylidene)-3,4-dihydro-2H-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 11796452 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[4-[(5E)-5-(cyanomethylidene)-3,4-dihydro-2H-1-benzazepine-1-carbonyl]phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCC/C(=C\C#N)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H23N3O2/c1-19-7-2-3-9-23(19)26(31)29-22-14-12-21(13-15-22)27(32)30-18-6-8-20(16-17-28)24-10-4-5-11-25(24)30/h2-5,7,9-16H,6,8,18H2,1H3,(H,29,31)/b20-16+ |
| InChIKey | DSPDHPQRFGCCMB-CAPFRKAQSA-N |
| XLogP | 5.59 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|