C27H22F2N2O4 — CID 67659491
2-[4,4-difluoro-1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid (PubChem CID 67659491) has the molecular formula C27H22F2N2O4 and a molecular weight of 476.48 g/mol. Its IUPAC name is 2-[4,4-difluoro-1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid.
| Compound Name | 2-[4,4-difluoro-1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
|---|---|
| PubChem CID | 67659491 |
| Molecular Formula | C27H22F2N2O4 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-[4,4-difluoro-1-[4-[(2-methylbenzoyl)amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCC(F)(F)C(=CC(=O)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H22F2N2O4/c1-17-6-2-3-7-20(17)25(34)30-19-12-10-18(11-13-19)26(35)31-15-14-27(28,29)22(16-24(32)33)21-8-4-5-9-23(21)31/h2-13,16H,14-15H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | OIAWIKDHEJHNRH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|