C27H19F5N2O4 — CID 67658919
2-[4,4-difluoro-1-[4-[[2-(trifluoromethyl)benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid (PubChem CID 67658919) has the molecular formula C27H19F5N2O4 and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[4,4-difluoro-1-[4-[[2-(trifluoromethyl)benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid.
| Compound Name | 2-[4,4-difluoro-1-[4-[[2-(trifluoromethyl)benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
|---|---|
| PubChem CID | 67658919 |
| Molecular Formula | C27H19F5N2O4 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-[4,4-difluoro-1-[4-[[2-(trifluoromethyl)benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
| SMILES | O=C(O)C=C1c2ccccc2N(C(=O)c2ccc(NC(=O)c3ccccc3C(F)(F)F)cc2)CCC1(F)F |
| InChI | InChI=1S/C27H19F5N2O4/c28-26(29)13-14-34(22-8-4-2-5-18(22)21(26)15-23(35)36)25(38)16-9-11-17(12-10-16)33-24(37)19-6-1-3-7-20(19)27(30,31)32/h1-12,15H,13-14H2,(H,33,37)(H,35,36) |
| InChIKey | JMAYPJPJWQURMF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|