C29H26F2N2O5 — CID 10864260
methyl (2Z)-2-[1-[4-[(2-ethoxybenzoyl)amino]benzoyl]-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate (PubChem CID 10864260) has the molecular formula C29H26F2N2O5 and a molecular weight of 520.53 g/mol. Its IUPAC name is methyl (2Z)-2-[1-[4-[(2-ethoxybenzoyl)amino]benzoyl]-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[1-[4-[(2-ethoxybenzoyl)amino]benzoyl]-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate |
|---|---|
| PubChem CID | 10864260 |
| Molecular Formula | C29H26F2N2O5 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | methyl (2Z)-2-[1-[4-[(2-ethoxybenzoyl)amino]benzoyl]-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc(C(=O)N2CCC(F)(F)/C(=C\C(=O)OC)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H26F2N2O5/c1-3-38-25-11-7-5-9-22(25)27(35)32-20-14-12-19(13-15-20)28(36)33-17-16-29(30,31)23(18-26(34)37-2)21-8-4-6-10-24(21)33/h4-15,18H,3,16-17H2,1-2H3,(H,32,35)/b23-18- |
| InChIKey | IQSGSIUHHUNWLA-NKFKGCMQSA-N |
| XLogP | 5.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|