About ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate
ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate (PubChem CID 139674490) has the molecular formula C21H20F2N2O3
and a molecular weight of 386.40 g/mol. Its IUPAC name is ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate |
| PubChem CID | 139674490 |
| Molecular Formula | C21H20F2N2O3 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/c2ccccc2N(C(=O)c2ccc(N)cc2)CCC1(F)F |
| InChI | InChI=1S/C21H20F2N2O3/c1-2-28-19(26)13-17-16-5-3-4-6-18(16)25(12-11-21(17,22)23)20(27)14-7-9-15(24)10-8-14/h3-10,13H,2,11-12,24H2,1H3/b17-13- |
| InChIKey | CCAMOQMDTSLLAI-LGMDPLHJSA-N |
| XLogP | 3.90 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
The IUPAC name of ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate (CID 139674490) is ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate is CCOC(=O)/C=C1/c2ccccc2N(C(=O)c2ccc(N)cc2)CCC1(F)F.
What is the InChIKey of ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
The InChIKey is CCAMOQMDTSLLAI-LGMDPLHJSA-N. The full InChI is InChI=1S/C21H20F2N2O3/c1-2-28-19(26)13-17-16-5-3-4-6-18(16)25(12-11-21(17,22)23)20(27)14-7-9-15(24)10-8-14/h3-10,13H,2,11-12,24H2,1H3/b17-13-.
What are the key properties of ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate has a molecular weight of 386.40 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate is sourced from PubChem (CID 139674490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).