C39H30F2N2O4 — CID 67752934
2-[4,4-difluoro-1-[4-[[2-[2-(3-methylphenyl)phenyl]benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid (PubChem CID 67752934) has the molecular formula C39H30F2N2O4 and a molecular weight of 628.68 g/mol. Its IUPAC name is 2-[4,4-difluoro-1-[4-[[2-[2-(3-methylphenyl)phenyl]benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid.
| Compound Name | 2-[4,4-difluoro-1-[4-[[2-[2-(3-methylphenyl)phenyl]benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
|---|---|
| PubChem CID | 67752934 |
| Molecular Formula | C39H30F2N2O4 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 2-[4,4-difluoro-1-[4-[[2-[2-(3-methylphenyl)phenyl]benzoyl]amino]benzoyl]-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
| SMILES | Cc1cccc(-c2ccccc2-c2ccccc2C(=O)Nc2ccc(C(=O)N3CCC(F)(F)C(=CC(=O)O)c4ccccc43)cc2)c1 |
| InChI | InChI=1S/C39H30F2N2O4/c1-25-9-8-10-27(23-25)29-11-2-3-12-30(29)31-13-4-5-14-32(31)37(46)42-28-19-17-26(18-20-28)38(47)43-22-21-39(40,41)34(24-36(44)45)33-15-6-7-16-35(33)43/h2-20,23-24H,21-22H2,1H3,(H,42,46)(H,44,45) |
| InChIKey | UZOFLOXKPVWPEF-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|