C19H16F2N2O3 — CID 67752824
2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid (PubChem CID 67752824) has the molecular formula C19H16F2N2O3 and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid.
| Compound Name | 2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
|---|---|
| PubChem CID | 67752824 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[1-(4-aminobenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetic acid |
| SMILES | Nc1ccc(C(=O)N2CCC(F)(F)C(=CC(=O)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H16F2N2O3/c20-19(21)9-10-23(18(26)12-5-7-13(22)8-6-12)16-4-2-1-3-14(16)15(19)11-17(24)25/h1-8,11H,9-10,22H2,(H,24,25) |
| InChIKey | LEFTVMMEAYJHCS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|