C26H34N2O3 — CID 11796509
2-cyclopentyl-2-hydroxy-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylacetamide (PubChem CID 11796509) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-cyclopentyl-2-hydroxy-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylacetamide.
| Compound Name | 2-cyclopentyl-2-hydroxy-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 11796509 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-cyclopentyl-2-hydroxy-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylacetamide |
| SMILES | COc1cccc(CN2CCC(NC(=O)C(O)(c3ccccc3)C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C26H34N2O3/c1-31-24-13-7-8-20(18-24)19-28-16-14-23(15-17-28)27-25(29)26(30,22-11-5-6-12-22)21-9-3-2-4-10-21/h2-4,7-10,13,18,22-23,30H,5-6,11-12,14-17,19H2,1H3,(H,27,29) |
| InChIKey | LRYVHUGMUSRZRA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |