C15H10BrCl2N3O3 — CID 11796916
3-bromo-8-[(2,6-dichloro-3-nitrophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine (PubChem CID 11796916) has the molecular formula C15H10BrCl2N3O3 and a molecular weight of 431.07 g/mol. Its IUPAC name is 3-bromo-8-[(2,6-dichloro-3-nitrophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine.
| Compound Name | 3-bromo-8-[(2,6-dichloro-3-nitrophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 11796916 |
| Molecular Formula | C15H10BrCl2N3O3 |
| Molecular Weight | 431.07 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 3-bromo-8-[(2,6-dichloro-3-nitrophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1nc2c(OCc3c(Cl)ccc([N+](=O)[O-])c3Cl)cccn2c1Br |
| InChI | InChI=1S/C15H10BrCl2N3O3/c1-8-14(16)20-6-2-3-12(15(20)19-8)24-7-9-10(17)4-5-11(13(9)18)21(22)23/h2-6H,7H2,1H3 |
| InChIKey | ORKHSKGMZMXCSI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.07 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|