C25H25N3O4 — CID 11796941
(3S,4R)-3-hydroxy-2,2-dimethyl-4-[[(1S,6R)-5-oxo-4-(2-phenylethyl)-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl]oxy]-3,4-dihydrochromene-6-carbonitrile (PubChem CID 11796941) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-2,2-dimethyl-4-[[(1S,6R)-5-oxo-4-(2-phenylethyl)-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl]oxy]-3,4-dihydrochromene-6-carbonitrile.
| Compound Name | (3S,4R)-3-hydroxy-2,2-dimethyl-4-[[(1S,6R)-5-oxo-4-(2-phenylethyl)-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl]oxy]-3,4-dihydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 11796941 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (3S,4R)-3-hydroxy-2,2-dimethyl-4-[[(1S,6R)-5-oxo-4-(2-phenylethyl)-3,4-diazabicyclo[4.1.0]hept-2-en-2-yl]oxy]-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](OC2=NN(CCc3ccccc3)C(=O)[C@@H]3C[C@H]23)[C@@H]1O |
| InChI | InChI=1S/C25H25N3O4/c1-25(2)22(29)21(19-12-16(14-26)8-9-20(19)32-25)31-23-17-13-18(17)24(30)28(27-23)11-10-15-6-4-3-5-7-15/h3-9,12,17-18,21-22,29H,10-11,13H2,1-2H3/t17-,18+,21+,22-/m0/s1 |
| InChIKey | KHFUNGJMGLOBMV-KKXYHZGYSA-N |
| XLogP | 3.18 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |