C13H11F13Si — CID 11797444
trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodec-3-en-1-ynyl]silane (PubChem CID 11797444) has the molecular formula C13H11F13Si and a molecular weight of 442.29 g/mol. Its IUPAC name is trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodec-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodec-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 11797444 |
| Molecular Formula | C13H11F13Si |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodec-3-en-1-ynyl]silane |
| SMILES | C[Si](C)(C)C#C/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F13Si/c1-27(2,3)7-5-4-6-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h4,6H,1-3H3/b6-4+ |
| InChIKey | XCIVTIJFNADRBP-GQCTYLIASA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|