C14H11F15Si — CID 10601178
trimethyl-[(Z)-4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-pentadecafluoroundec-3-en-1-ynyl]silane (PubChem CID 10601178) has the molecular formula C14H11F15Si and a molecular weight of 492.30 g/mol. Its IUPAC name is trimethyl-[(Z)-4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-pentadecafluoroundec-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[(Z)-4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-pentadecafluoroundec-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 10601178 |
| Molecular Formula | C14H11F15Si |
| Molecular Weight | 492.30 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | trimethyl-[(Z)-4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-pentadecafluoroundec-3-en-1-ynyl]silane |
| SMILES | C[Si](C)(C)C#C/C=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H11F15Si/c1-30(2,3)6-4-5-7(15)9(18,19)11(22,23)13(26,27)14(28,29)12(24,25)10(20,21)8(16)17/h5,8H,1-3H3/b7-5- |
| InChIKey | QLLTVPQNMLWSGR-ALCCZGGFSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.30 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|