C19H23F13Si — CID 10768442
trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hexyldec-3-en-1-ynyl]silane (PubChem CID 10768442) has the molecular formula C19H23F13Si and a molecular weight of 526.45 g/mol. Its IUPAC name is trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hexyldec-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hexyldec-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 10768442 |
| Molecular Formula | C19H23F13Si |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | trimethyl-[(E)-5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-3-hexyldec-3-en-1-ynyl]silane |
| SMILES | CCCCCC/C(C#C[Si](C)(C)C)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H23F13Si/c1-5-6-7-8-9-13(10-11-33(2,3)4)12-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h12H,5-9H2,1-4H3/b13-12+ |
| InChIKey | MMMPVYXSUOXCKX-OUKQBFOZSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|