C14H22F2Si — CID 154320834
(11,11-difluoro-10-methylundeca-6,10-dien-8-yn-5-yl)-dimethylsilane (PubChem CID 154320834) has the molecular formula C14H22F2Si and a molecular weight of 256.41 g/mol. Its IUPAC name is (11,11-difluoro-10-methylundeca-6,10-dien-8-yn-5-yl)-dimethylsilane.
| Compound Name | (11,11-difluoro-10-methylundeca-6,10-dien-8-yn-5-yl)-dimethylsilane |
|---|---|
| PubChem CID | 154320834 |
| Molecular Formula | C14H22F2Si |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (11,11-difluoro-10-methylundeca-6,10-dien-8-yn-5-yl)-dimethylsilane |
| SMILES | CCCCC(C=CC#CC(C)=C(F)F)[SiH](C)C |
| InChI | InChI=1S/C14H22F2Si/c1-5-6-10-13(17(3)4)11-8-7-9-12(2)14(15)16/h8,11,13,17H,5-6,10H2,1-4H3 |
| InChIKey | SPLWGQDNENKLAR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|