C17H23F9Si — CID 177494706
trimethyl-[(3Z)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)non-1-ynyl]silane (PubChem CID 177494706) has the molecular formula C17H23F9Si and a molecular weight of 426.44 g/mol. Its IUPAC name is trimethyl-[(3Z)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)non-1-ynyl]silane.
| Compound Name | trimethyl-[(3Z)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)non-1-ynyl]silane |
|---|---|
| PubChem CID | 177494706 |
| Molecular Formula | C17H23F9Si |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | trimethyl-[(3Z)-3-(2,2,3,3,4,4,5,5,5-nonafluoropentylidene)non-1-ynyl]silane |
| SMILES | CCCCCC/C(C#C[Si](C)(C)C)=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H23F9Si/c1-5-6-7-8-9-13(10-11-27(2,3)4)12-14(18,19)15(20,21)16(22,23)17(24,25)26/h12H,5-9H2,1-4H3/b13-12- |
| InChIKey | YHIXQYCHIQXZAT-SEYXRHQNSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|