C18H23F9 — CID 11292777
(E)-6-(3,3-dimethylbut-1-ynyl)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene (PubChem CID 11292777) has the molecular formula C18H23F9 and a molecular weight of 410.36 g/mol. Its IUPAC name is (E)-6-(3,3-dimethylbut-1-ynyl)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene.
| Compound Name | (E)-6-(3,3-dimethylbut-1-ynyl)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene |
|---|---|
| PubChem CID | 11292777 |
| Molecular Formula | C18H23F9 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (E)-6-(3,3-dimethylbut-1-ynyl)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene |
| SMILES | CCCCCC/C(C#CC(C)(C)C)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H23F9/c1-5-6-7-8-9-13(10-11-14(2,3)4)12-15(19,20)16(21,22)17(23,24)18(25,26)27/h12H,5-9H2,1-4H3/b13-12+ |
| InChIKey | OARXQVGKLUEHEZ-OUKQBFOZSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|