C16H16F4 — CID 144809461
1-methyl-4-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-en-1-ynyl)cyclohexa-1,3-diene (PubChem CID 144809461) has the molecular formula C16H16F4 and a molecular weight of 284.30 g/mol. Its IUPAC name is 1-methyl-4-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-en-1-ynyl)cyclohexa-1,3-diene.
| Compound Name | 1-methyl-4-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-en-1-ynyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144809461 |
| Molecular Formula | C16H16F4 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-methyl-4-(4,4,5,5-tetrafluoro-6-methyl-3-methylidenehept-6-en-1-ynyl)cyclohexa-1,3-diene |
| SMILES | C=C(C)C(F)(F)C(F)(F)C(=C)C#CC1=CC=C(C)CC1 |
| InChI | InChI=1S/C16H16F4/c1-11(2)15(17,18)16(19,20)13(4)7-10-14-8-5-12(3)6-9-14/h5,8H,1,4,6,9H2,2-3H3 |
| InChIKey | IKMUZLQMUMGLGO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|