C14H18F2 — CID 121461068
(4E,6Z)-5-(1,1-difluoroethyl)-3-methylideneundeca-4,6-dien-1-yne (PubChem CID 121461068) has the molecular formula C14H18F2 and a molecular weight of 224.29 g/mol. Its IUPAC name is (4E,6Z)-5-(1,1-difluoroethyl)-3-methylideneundeca-4,6-dien-1-yne.
| Compound Name | (4E,6Z)-5-(1,1-difluoroethyl)-3-methylideneundeca-4,6-dien-1-yne |
|---|---|
| PubChem CID | 121461068 |
| Molecular Formula | C14H18F2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (4E,6Z)-5-(1,1-difluoroethyl)-3-methylideneundeca-4,6-dien-1-yne |
| SMILES | C#CC(=C)/C=C(\C=C/CCCC)C(C)(F)F |
| InChI | InChI=1S/C14H18F2/c1-5-7-8-9-10-13(14(4,15)16)11-12(3)6-2/h2,9-11H,3,5,7-8H2,1,4H3/b10-9-,13-11+ |
| InChIKey | WKEVIVGZMFFWBY-AZQRDTPRSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|