C12H17F3 — CID 91064604
6-methyl-3-(trifluoromethyl)deca-2,4,6-triene (PubChem CID 91064604) has the molecular formula C12H17F3 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-methyl-3-(trifluoromethyl)deca-2,4,6-triene.
| Compound Name | 6-methyl-3-(trifluoromethyl)deca-2,4,6-triene |
|---|---|
| PubChem CID | 91064604 |
| Molecular Formula | C12H17F3 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-methyl-3-(trifluoromethyl)deca-2,4,6-triene |
| SMILES | CC=C(C=CC(C)=CCCC)C(F)(F)F |
| InChI | InChI=1S/C12H17F3/c1-4-6-7-10(3)8-9-11(5-2)12(13,14)15/h5,7-9H,4,6H2,1-3H3 |
| InChIKey | UZGLNIFNBMKNDI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|