C13H16F6 — CID 90816058
4-methyl-2,6-bis(trifluoromethyl)deca-1,3,5-triene (PubChem CID 90816058) has the molecular formula C13H16F6 and a molecular weight of 286.26 g/mol. Its IUPAC name is 4-methyl-2,6-bis(trifluoromethyl)deca-1,3,5-triene.
| Compound Name | 4-methyl-2,6-bis(trifluoromethyl)deca-1,3,5-triene |
|---|---|
| PubChem CID | 90816058 |
| Molecular Formula | C13H16F6 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-methyl-2,6-bis(trifluoromethyl)deca-1,3,5-triene |
| SMILES | C=C(C=C(C)C=C(CCCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H16F6/c1-4-5-6-11(13(17,18)19)8-9(2)7-10(3)12(14,15)16/h7-8H,3-6H2,1-2H3 |
| InChIKey | VCMIJVJHBDDDDY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|