C16H24F4 — CID 121476158
5,5,6,6-tetrafluoro-1-heptyl-4-propylcyclohexa-1,3-diene (PubChem CID 121476158) has the molecular formula C16H24F4 and a molecular weight of 292.36 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-heptyl-4-propylcyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-heptyl-4-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476158 |
| Molecular Formula | C16H24F4 |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-heptyl-4-propylcyclohexa-1,3-diene |
| SMILES | CCCCCCCC1=CC=C(CCC)C(F)(F)C1(F)F |
| InChI | InChI=1S/C16H24F4/c1-3-5-6-7-8-10-14-12-11-13(9-4-2)15(17,18)16(14,19)20/h11-12H,3-10H2,1-2H3 |
| InChIKey | WXVMVZXSJCGZRZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|