C10H9F9 — CID 11370031
1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexene (PubChem CID 11370031) has the molecular formula C10H9F9 and a molecular weight of 300.16 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexene |
|---|---|
| PubChem CID | 11370031 |
| Molecular Formula | C10H9F9 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclohexene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1=CCCCC1 |
| InChI | InChI=1S/C10H9F9/c11-7(12,6-4-2-1-3-5-6)8(13,14)9(15,16)10(17,18)19/h4H,1-3,5H2 |
| InChIKey | QFVFTHFLWPPFJZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|