C13H11F15 — CID 54254754
7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-ene (PubChem CID 54254754) has the molecular formula C13H11F15 and a molecular weight of 452.20 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-ene.
| Compound Name | 7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-ene |
|---|---|
| PubChem CID | 54254754 |
| Molecular Formula | C13H11F15 |
| Molecular Weight | 452.20 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-ene |
| SMILES | CCCCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F15/c1-2-3-4-5-6-7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h5-6H,2-4H2,1H3 |
| InChIKey | PBFFYNBAOSKDGF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.20 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|