C9H5F13 — CID 2776255
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-ene (PubChem CID 2776255) has the molecular formula C9H5F13 and a molecular weight of 360.11 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-ene.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-ene |
|---|---|
| PubChem CID | 2776255 |
| Molecular Formula | C9H5F13 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoronon-2-ene |
| SMILES | CC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F13/c1-2-3-4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h2-3H,1H3 |
| InChIKey | ZYHWHNDIVSRFMS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|