C13H13F13 — CID 11761506
(E)-8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridec-6-ene (PubChem CID 11761506) has the molecular formula C13H13F13 and a molecular weight of 416.22 g/mol. Its IUPAC name is (E)-8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridec-6-ene.
| Compound Name | (E)-8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridec-6-ene |
|---|---|
| PubChem CID | 11761506 |
| Molecular Formula | C13H13F13 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (E)-8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridec-6-ene |
| SMILES | CCCCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H13F13/c1-2-3-4-5-6-7-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h6-7H,2-5H2,1H3/b7-6+ |
| InChIKey | CYIMORLVMXKPBZ-VOTSOKGWSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|