C14H15F13 — CID 2776180
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorotetradec-7-ene (PubChem CID 2776180) has the molecular formula C14H15F13 and a molecular weight of 430.25 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorotetradec-7-ene.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorotetradec-7-ene |
|---|---|
| PubChem CID | 2776180 |
| Molecular Formula | C14H15F13 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorotetradec-7-ene |
| SMILES | CCCCCCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F13/c1-2-3-4-5-6-7-8-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h7-8H,2-6H2,1H3 |
| InChIKey | JNMMIYWYYKPWFO-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|