C9H11F7 — CID 2774929
1,1,1,2,2,3,3-heptafluoronon-4-ene (PubChem CID 2774929) has the molecular formula C9H11F7 and a molecular weight of 252.17 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoronon-4-ene.
| Compound Name | 1,1,1,2,2,3,3-heptafluoronon-4-ene |
|---|---|
| PubChem CID | 2774929 |
| Molecular Formula | C9H11F7 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoronon-4-ene |
| SMILES | CCCCC=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F7/c1-2-3-4-5-6-7(10,11)8(12,13)9(14,15)16/h5-6H,2-4H2,1H3 |
| InChIKey | DZBBLQUHQSLWOV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|