C24H40F6 — CID 14665882
(9E,13E)-9,14-bis(trifluoromethyl)docosa-9,13-diene (PubChem CID 14665882) has the molecular formula C24H40F6 and a molecular weight of 442.57 g/mol. Its IUPAC name is (9E,13E)-9,14-bis(trifluoromethyl)docosa-9,13-diene.
| Compound Name | (9E,13E)-9,14-bis(trifluoromethyl)docosa-9,13-diene |
|---|---|
| PubChem CID | 14665882 |
| Molecular Formula | C24H40F6 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | (9E,13E)-9,14-bis(trifluoromethyl)docosa-9,13-diene |
| SMILES | CCCCCCCC/C(=C\CC/C=C(\CCCCCCCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H40F6/c1-3-5-7-9-11-13-17-21(23(25,26)27)19-15-16-20-22(24(28,29)30)18-14-12-10-8-6-4-2/h19-20H,3-18H2,1-2H3/b21-19+,22-20+ |
| InChIKey | BHYVMGCRZVTFGI-FLFKKZLDSA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|