C15H23F3 — CID 10563303
(8E)-8-(2,2,2-trifluoroethylidene)tridec-6-yne (PubChem CID 10563303) has the molecular formula C15H23F3 and a molecular weight of 260.34 g/mol. Its IUPAC name is (8E)-8-(2,2,2-trifluoroethylidene)tridec-6-yne.
| Compound Name | (8E)-8-(2,2,2-trifluoroethylidene)tridec-6-yne |
|---|---|
| PubChem CID | 10563303 |
| Molecular Formula | C15H23F3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (8E)-8-(2,2,2-trifluoroethylidene)tridec-6-yne |
| SMILES | CCCCCC#C/C(=C/C(F)(F)F)CCCCC |
| InChI | InChI=1S/C15H23F3/c1-3-5-7-8-10-12-14(11-9-6-4-2)13-15(16,17)18/h13H,3-9,11H2,1-2H3/b14-13+ |
| InChIKey | AZWLCMZCSVJJID-BUHFOSPRSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|