C22H22F4 — CID 144809549
1-methyl-4-[(9Z)-3,3,4,4-tetrafluoro-11-methyl-5,8-dimethylidenedodeca-1,9,11-trien-6-yn-2-yl]cyclohexa-1,3-diene (PubChem CID 144809549) has the molecular formula C22H22F4 and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-methyl-4-[(9Z)-3,3,4,4-tetrafluoro-11-methyl-5,8-dimethylidenedodeca-1,9,11-trien-6-yn-2-yl]cyclohexa-1,3-diene.
| Compound Name | 1-methyl-4-[(9Z)-3,3,4,4-tetrafluoro-11-methyl-5,8-dimethylidenedodeca-1,9,11-trien-6-yn-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144809549 |
| Molecular Formula | C22H22F4 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-methyl-4-[(9Z)-3,3,4,4-tetrafluoro-11-methyl-5,8-dimethylidenedodeca-1,9,11-trien-6-yn-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(C)/C=C\C(=C)C#CC(=C)C(F)(F)C(F)(F)C(=C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C22H22F4/c1-15(2)7-8-16(3)9-12-18(5)21(23,24)22(25,26)19(6)20-13-10-17(4)11-14-20/h7-8,10,13H,1,3,5-6,11,14H2,2,4H3/b8-7- |
| InChIKey | KOCIDCVQDYRTPR-FPLPWBNLSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|