C15H12F8 — CID 121476185
5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene (PubChem CID 121476185) has the molecular formula C15H12F8 and a molecular weight of 344.25 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene.
| Compound Name | 5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476185 |
| Molecular Formula | C15H12F8 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5,5,6,6-tetrafluoro-1-propyl-4-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(C2=CC=CC(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H12F8/c1-2-4-9-6-7-11(15(22,23)13(9,18)19)10-5-3-8-12(16,17)14(10,20)21/h3,5-8H,2,4H2,1H3 |
| InChIKey | DGOLINUZPDRFDY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|