C14H16F4 — CID 121476160
1,4-Bis(but-3-enyl)-5,5,6,6-tetrafluorocyclohexa-1,3-diene (PubChem CID 121476160) has the molecular formula C14H16F4 and a molecular weight of 260.27 g/mol. Its IUPAC name is 1,4-bis(but-3-enyl)-5,5,6,6-tetrafluorocyclohexa-1,3-diene.
| Compound Name | 1,4-Bis(but-3-enyl)-5,5,6,6-tetrafluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121476160 |
| Molecular Formula | C14H16F4 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1,4-bis(but-3-enyl)-5,5,6,6-tetrafluorocyclohexa-1,3-diene |
| SMILES | C=CCCC1=CC=C(C(C1(F)F)(F)F)CCC=C |
| InChI | InChI=1S/C14H16F4/c1-3-5-7-11-9-10-12(8-6-4-2)14(17,18)13(11,15)16/h3-4,9-10H,1-2,5-8H2 |
| InChIKey | SDMLHWDPEJPMAE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | 351 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|