C18H20ClNO10 — CID 11797609
dimethyl 2-[2-[2-chloro-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitrophenyl]ethyl]propanedioate (PubChem CID 11797609) has the molecular formula C18H20ClNO10 and a molecular weight of 445.81 g/mol. Its IUPAC name is dimethyl 2-[2-[2-chloro-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitrophenyl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[2-chloro-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitrophenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 11797609 |
| Molecular Formula | C18H20ClNO10 |
| Molecular Weight | 445.81 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | dimethyl 2-[2-[2-chloro-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-4-nitrophenyl]ethyl]propanedioate |
| SMILES | COC(=O)C(CCc1cc(C(C(=O)OC)C(=O)OC)c([N+](=O)[O-])cc1Cl)C(=O)OC |
| InChI | InChI=1S/C18H20ClNO10/c1-27-15(21)10(16(22)28-2)6-5-9-7-11(13(20(25)26)8-12(9)19)14(17(23)29-3)18(24)30-4/h7-8,10,14H,5-6H2,1-4H3 |
| InChIKey | XEXZLGYLVCQYMF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.81 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|