C22H30ClN3O8 — CID 67760003
dimethyl 2-[4-chloro-5-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-piperazin-1-ylpropan-2-yl]-2-nitrophenyl]propanedioate (PubChem CID 67760003) has the molecular formula C22H30ClN3O8 and a molecular weight of 499.95 g/mol. Its IUPAC name is dimethyl 2-[4-chloro-5-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-piperazin-1-ylpropan-2-yl]-2-nitrophenyl]propanedioate.
| Compound Name | dimethyl 2-[4-chloro-5-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-piperazin-1-ylpropan-2-yl]-2-nitrophenyl]propanedioate |
|---|---|
| PubChem CID | 67760003 |
| Molecular Formula | C22H30ClN3O8 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | dimethyl 2-[4-chloro-5-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-piperazin-1-ylpropan-2-yl]-2-nitrophenyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1cc(C(CN2CCNCC2)C(=O)OC(C)(C)C)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H30ClN3O8/c1-22(2,3)34-19(27)15(12-25-8-6-24-7-9-25)13-10-14(17(26(30)31)11-16(13)23)18(20(28)32-4)21(29)33-5/h10-11,15,18,24H,6-9,12H2,1-5H3 |
| InChIKey | NCMFETBGIPYMPU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|